C8H5ClN2O — CID 53485717
6-chloro-1H-1,8-naphthyridin-4-one (PubChem CID 53485717) has the molecular formula C8H5ClN2O and a molecular weight of 180.59 g/mol. Its IUPAC name is 6-chloro-1H-1,8-naphthyridin-4-one.
| Compound Name | 6-chloro-1H-1,8-naphthyridin-4-one |
|---|---|
| PubChem CID | 53485717 |
| Molecular Formula | C8H5ClN2O |
| Molecular Weight | 180.59 g/mol |
| Exact Mass | 180.01 |
| IUPAC Name | 6-chloro-1H-1,8-naphthyridin-4-one |
| SMILES | O=c1cc[nH]c2ncc(Cl)cc12 |
| InChI | InChI=1S/C8H5ClN2O/c9-5-3-6-7(12)1-2-10-8(6)11-4-5/h1-4H,(H,10,11,12) |
| InChIKey | KTRCAEQIJGGDAH-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.59 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |