C9H8N2O4 — CID 71376841
6-hydroxy-8-nitro-3,4-dihydro-1H-quinolin-2-one (PubChem CID 71376841) has the molecular formula C9H8N2O4 and a molecular weight of 208.17 g/mol. Its IUPAC name is 6-hydroxy-8-nitro-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-hydroxy-8-nitro-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 71376841 |
| Molecular Formula | C9H8N2O4 |
| Molecular Weight | 208.17 g/mol |
| Exact Mass | 208.05 |
| IUPAC Name | 6-hydroxy-8-nitro-3,4-dihydro-1H-quinolin-2-one |
| SMILES | O=C1CCc2cc(O)cc([N+](=O)[O-])c2N1 |
| InChI | InChI=1S/C9H8N2O4/c12-6-3-5-1-2-8(13)10-9(5)7(4-6)11(14)15/h3-4,12H,1-2H2,(H,10,13) |
| InChIKey | DUZFNLYYHUGWLN-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.17 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|