C11H13N3O3 — CID 43449821
6-(ethylamino)-7-nitro-3,4-dihydro-1H-quinolin-2-one (PubChem CID 43449821) has the molecular formula C11H13N3O3 and a molecular weight of 235.24 g/mol. Its IUPAC name is 6-(ethylamino)-7-nitro-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-(ethylamino)-7-nitro-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 43449821 |
| Molecular Formula | C11H13N3O3 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 6-(ethylamino)-7-nitro-3,4-dihydro-1H-quinolin-2-one |
| SMILES | CCNc1cc2c(cc1[N+](=O)[O-])NC(=O)CC2 |
| InChI | InChI=1S/C11H13N3O3/c1-2-12-9-5-7-3-4-11(15)13-8(7)6-10(9)14(16)17/h5-6,12H,2-4H2,1H3,(H,13,15) |
| InChIKey | ASLYJSISSHKESW-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|