C11H10F3N3O3 — CID 43449837
7-nitro-6-(2,2,2-trifluoroethylamino)-3,4-dihydro-1H-quinolin-2-one (PubChem CID 43449837) has the molecular formula C11H10F3N3O3 and a molecular weight of 289.21 g/mol. Its IUPAC name is 7-nitro-6-(2,2,2-trifluoroethylamino)-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 7-nitro-6-(2,2,2-trifluoroethylamino)-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 43449837 |
| Molecular Formula | C11H10F3N3O3 |
| Molecular Weight | 289.21 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | 7-nitro-6-(2,2,2-trifluoroethylamino)-3,4-dihydro-1H-quinolin-2-one |
| SMILES | O=C1CCc2cc(NCC(F)(F)F)c([N+](=O)[O-])cc2N1 |
| InChI | InChI=1S/C11H10F3N3O3/c12-11(13,14)5-15-8-3-6-1-2-10(18)16-7(6)4-9(8)17(19)20/h3-4,15H,1-2,5H2,(H,16,18) |
| InChIKey | JBRLFUTVIZNBML-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.21 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|