C10H9F2NO — CID 166091425
7,8-difluoro-6-methyl-3,4-dihydro-1H-quinolin-2-one (PubChem CID 166091425) has the molecular formula C10H9F2NO and a molecular weight of 197.18 g/mol. Its IUPAC name is 7,8-difluoro-6-methyl-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 7,8-difluoro-6-methyl-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 166091425 |
| Molecular Formula | C10H9F2NO |
| Molecular Weight | 197.18 g/mol |
| Exact Mass | 197.07 |
| IUPAC Name | 7,8-difluoro-6-methyl-3,4-dihydro-1H-quinolin-2-one |
| SMILES | Cc1cc2c(c(F)c1F)NC(=O)CC2 |
| InChI | InChI=1S/C10H9F2NO/c1-5-4-6-2-3-7(14)13-10(6)9(12)8(5)11/h4H,2-3H2,1H3,(H,13,14) |
| InChIKey | IQQAHUXBKYWHLF-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.18 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |