C10H10N4O — CID 169326609
8-azido-6-methyl-3,4-dihydro-1H-quinolin-2-one (PubChem CID 169326609) has the molecular formula C10H10N4O and a molecular weight of 202.22 g/mol. Its IUPAC name is 8-azido-6-methyl-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 8-azido-6-methyl-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 169326609 |
| Molecular Formula | C10H10N4O |
| Molecular Weight | 202.22 g/mol |
| Exact Mass | 202.09 |
| IUPAC Name | 8-azido-6-methyl-3,4-dihydro-1H-quinolin-2-one |
| SMILES | Cc1cc2c(c(N=[N+]=[N-])c1)NC(=O)CC2 |
| InChI | InChI=1S/C10H10N4O/c1-6-4-7-2-3-9(15)12-10(7)8(5-6)13-14-11/h4-5H,2-3H2,1H3,(H,12,15) |
| InChIKey | YEFJGWYQLGKNLX-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 77.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.22 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|