8-methyl-2-oxo-3,4-dihydro-1H-quinoline-6-carboxylic acid

C11H11NO3 — CID 11106499

IUPAC8-methyl-2-oxo-3,4-dihydro-1H-quinoline-6-carboxylic acid
SMILESCc1cc(C(=O)O)cc2c1NC(=O)CC2
InChIInChI=1S/C11H11NO3/c1-6-4-8(11(14)15)5-7-2-3-9(13)12-10(6)7/h4-5H,2-3H2,1H3,(H,12,13)(H,14,15)
InChIKeyVQCQNXNGGMKSES-UHFFFAOYSA-N
MW205.21 g/mol
LogP1.58
Rot. Bonds1

About 8-methyl-2-oxo-3,4-dihydro-1H-quinoline-6-carboxylic acid

8-methyl-2-oxo-3,4-dihydro-1H-quinoline-6-carboxylic acid (PubChem CID 11106499) has the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. Its IUPAC name is 8-methyl-2-oxo-3,4-dihydro-1H-quinoline-6-carboxylic acid.

Molecular Properties

Compound Name8-methyl-2-oxo-3,4-dihydro-1H-quinoline-6-carboxylic acid
PubChem CID11106499
Molecular FormulaC11H11NO3
Molecular Weight205.21 g/mol
Exact Mass205.07
IUPAC Name8-methyl-2-oxo-3,4-dihydro-1H-quinoline-6-carboxylic acid
SMILESCc1cc(C(=O)O)cc2c1NC(=O)CC2
InChIInChI=1S/C11H11NO3/c1-6-4-8(11(14)15)5-7-2-3-9(13)12-10(6)7/h4-5H,2-3H2,1H3,(H,12,13)(H,14,15)
InChIKeyVQCQNXNGGMKSES-UHFFFAOYSA-N
XLogP1.58
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500205.21
LogP ≤ 51.58
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 8-methyl-2-oxo-3,4-dihydro-1H-quinoline-6-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 8-methyl-2-oxo-3,4-dihydro-1H-quinoline-6-carboxylic acid?
The IUPAC name of 8-methyl-2-oxo-3,4-dihydro-1H-quinoline-6-carboxylic acid (CID 11106499) is 8-methyl-2-oxo-3,4-dihydro-1H-quinoline-6-carboxylic acid.
What is the SMILES notation for 8-methyl-2-oxo-3,4-dihydro-1H-quinoline-6-carboxylic acid?
The canonical SMILES for 8-methyl-2-oxo-3,4-dihydro-1H-quinoline-6-carboxylic acid is Cc1cc(C(=O)O)cc2c1NC(=O)CC2.
What is the InChIKey of 8-methyl-2-oxo-3,4-dihydro-1H-quinoline-6-carboxylic acid?
The InChIKey is VQCQNXNGGMKSES-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO3/c1-6-4-8(11(14)15)5-7-2-3-9(13)12-10(6)7/h4-5H,2-3H2,1H3,(H,12,13)(H,14,15).
What are the key properties of 8-methyl-2-oxo-3,4-dihydro-1H-quinoline-6-carboxylic acid?
8-methyl-2-oxo-3,4-dihydro-1H-quinoline-6-carboxylic acid has a molecular weight of 205.21 g/mol, XLogP of 1.58, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methyl-2-oxo-3,4-dihydro-1H-quinoline-6-carboxylic acid is sourced from PubChem (CID 11106499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).