C18H23ClN2O3 — CID 58495308
tert-butyl 11-chloro-2-oxo-3,4,6,7,9,10-hexahydro-1H-pyrido[2,3-h][3]benzazepine-8-carboxylate (PubChem CID 58495308) has the molecular formula C18H23ClN2O3 and a molecular weight of 350.85 g/mol. Its IUPAC name is tert-butyl 11-chloro-2-oxo-3,4,6,7,9,10-hexahydro-1H-pyrido[2,3-h][3]benzazepine-8-carboxylate.
| Compound Name | tert-butyl 11-chloro-2-oxo-3,4,6,7,9,10-hexahydro-1H-pyrido[2,3-h][3]benzazepine-8-carboxylate |
|---|---|
| PubChem CID | 58495308 |
| Molecular Formula | C18H23ClN2O3 |
| Molecular Weight | 350.85 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | tert-butyl 11-chloro-2-oxo-3,4,6,7,9,10-hexahydro-1H-pyrido[2,3-h][3]benzazepine-8-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCc2cc3c(c(Cl)c2CC1)NC(=O)CC3 |
| InChI | InChI=1S/C18H23ClN2O3/c1-18(2,3)24-17(23)21-8-6-11-10-12-4-5-14(22)20-16(12)15(19)13(11)7-9-21/h10H,4-9H2,1-3H3,(H,20,22) |
| InChIKey | CAFZMXNAGKEDDO-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.85 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |