C21H31ClN2O3 — CID 70667080
tert-butyl 11-chloro-1-(2-methoxyethyl)-3,4,6,7,9,10-hexahydro-2H-pyrido[2,3-h][3]benzazepine-8-carboxylate (PubChem CID 70667080) has the molecular formula C21H31ClN2O3 and a molecular weight of 394.94 g/mol. Its IUPAC name is tert-butyl 11-chloro-1-(2-methoxyethyl)-3,4,6,7,9,10-hexahydro-2H-pyrido[2,3-h][3]benzazepine-8-carboxylate.
| Compound Name | tert-butyl 11-chloro-1-(2-methoxyethyl)-3,4,6,7,9,10-hexahydro-2H-pyrido[2,3-h][3]benzazepine-8-carboxylate |
|---|---|
| PubChem CID | 70667080 |
| Molecular Formula | C21H31ClN2O3 |
| Molecular Weight | 394.94 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | tert-butyl 11-chloro-1-(2-methoxyethyl)-3,4,6,7,9,10-hexahydro-2H-pyrido[2,3-h][3]benzazepine-8-carboxylate |
| SMILES | COCCN1CCCc2cc3c(c(Cl)c21)CCN(C(=O)OC(C)(C)C)CC3 |
| InChI | InChI=1S/C21H31ClN2O3/c1-21(2,3)27-20(25)24-10-7-15-14-16-6-5-9-23(12-13-26-4)19(16)18(22)17(15)8-11-24/h14H,5-13H2,1-4H3 |
| InChIKey | ZSNYAAQPNYGDOZ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.94 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |