C27H36N2O3 — CID 71289679
tert-butyl 1-(2-methoxyethyl)-11-phenyl-3,4,6,7,9,10-hexahydro-2H-pyrido[3,2-h][3]benzazepine-8-carboxylate (PubChem CID 71289679) has the molecular formula C27H36N2O3 and a molecular weight of 436.60 g/mol. Its IUPAC name is tert-butyl 1-(2-methoxyethyl)-11-phenyl-3,4,6,7,9,10-hexahydro-2H-pyrido[3,2-h][3]benzazepine-8-carboxylate.
| Compound Name | tert-butyl 1-(2-methoxyethyl)-11-phenyl-3,4,6,7,9,10-hexahydro-2H-pyrido[3,2-h][3]benzazepine-8-carboxylate |
|---|---|
| PubChem CID | 71289679 |
| Molecular Formula | C27H36N2O3 |
| Molecular Weight | 436.60 g/mol |
| Exact Mass | 436.27 |
| IUPAC Name | tert-butyl 1-(2-methoxyethyl)-11-phenyl-3,4,6,7,9,10-hexahydro-2H-pyrido[3,2-h][3]benzazepine-8-carboxylate |
| SMILES | COCCN1CCCc2cc3c(c(-c4ccccc4)c21)CCN(C(=O)OC(C)(C)C)CC3 |
| InChI | InChI=1S/C27H36N2O3/c1-27(2,3)32-26(30)29-15-12-21-19-22-11-8-14-28(17-18-31-4)25(22)24(23(21)13-16-29)20-9-6-5-7-10-20/h5-7,9-10,19H,8,11-18H2,1-4H3 |
| InChIKey | VAQHUOWXZWTZAM-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.60 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |