C24H29BrN2O3 — CID 58494910
tert-butyl 4-benzyl-5-bromo-2,3,6,7,9,10-hexahydro-[1,4]oxazino[2,3-h][3]benzazepine-8-carboxylate (PubChem CID 58494910) has the molecular formula C24H29BrN2O3 and a molecular weight of 473.41 g/mol. Its IUPAC name is tert-butyl 4-benzyl-5-bromo-2,3,6,7,9,10-hexahydro-[1,4]oxazino[2,3-h][3]benzazepine-8-carboxylate.
| Compound Name | tert-butyl 4-benzyl-5-bromo-2,3,6,7,9,10-hexahydro-[1,4]oxazino[2,3-h][3]benzazepine-8-carboxylate |
|---|---|
| PubChem CID | 58494910 |
| Molecular Formula | C24H29BrN2O3 |
| Molecular Weight | 473.41 g/mol |
| Exact Mass | 472.14 |
| IUPAC Name | tert-butyl 4-benzyl-5-bromo-2,3,6,7,9,10-hexahydro-[1,4]oxazino[2,3-h][3]benzazepine-8-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCc2cc3c(c(Br)c2CC1)N(Cc1ccccc1)CCO3 |
| InChI | InChI=1S/C24H29BrN2O3/c1-24(2,3)30-23(28)26-11-9-18-15-20-22(21(25)19(18)10-12-26)27(13-14-29-20)16-17-7-5-4-6-8-17/h4-8,15H,9-14,16H2,1-3H3 |
| InChIKey | FSHKJJUNNGTWAY-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.41 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |