C22H32F2N2O3 — CID 58495212
tert-butyl 4-(2,2-difluorobutyl)-5-methyl-2,3,6,7,9,10-hexahydro-[1,4]oxazino[2,3-h][3]benzazepine-8-carboxylate (PubChem CID 58495212) has the molecular formula C22H32F2N2O3 and a molecular weight of 410.51 g/mol. Its IUPAC name is tert-butyl 4-(2,2-difluorobutyl)-5-methyl-2,3,6,7,9,10-hexahydro-[1,4]oxazino[2,3-h][3]benzazepine-8-carboxylate.
| Compound Name | tert-butyl 4-(2,2-difluorobutyl)-5-methyl-2,3,6,7,9,10-hexahydro-[1,4]oxazino[2,3-h][3]benzazepine-8-carboxylate |
|---|---|
| PubChem CID | 58495212 |
| Molecular Formula | C22H32F2N2O3 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.24 |
| IUPAC Name | tert-butyl 4-(2,2-difluorobutyl)-5-methyl-2,3,6,7,9,10-hexahydro-[1,4]oxazino[2,3-h][3]benzazepine-8-carboxylate |
| SMILES | CCC(F)(F)CN1CCOc2cc3c(c(C)c21)CCN(C(=O)OC(C)(C)C)CC3 |
| InChI | InChI=1S/C22H32F2N2O3/c1-6-22(23,24)14-26-11-12-28-18-13-16-7-9-25(20(27)29-21(3,4)5)10-8-17(16)15(2)19(18)26/h13H,6-12,14H2,1-5H3 |
| InChIKey | XOPUCOWHRVWJAF-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |