C22H31BrN2O4 — CID 58495074
tert-butyl 5-bromo-4-[[(2R)-oxolan-2-yl]methyl]-2,3,6,7,9,10-hexahydro-[1,4]oxazino[2,3-h][3]benzazepine-8-carboxylate (PubChem CID 58495074) has the molecular formula C22H31BrN2O4 and a molecular weight of 467.40 g/mol. Its IUPAC name is tert-butyl 5-bromo-4-[[(2R)-oxolan-2-yl]methyl]-2,3,6,7,9,10-hexahydro-[1,4]oxazino[2,3-h][3]benzazepine-8-carboxylate.
| Compound Name | tert-butyl 5-bromo-4-[[(2R)-oxolan-2-yl]methyl]-2,3,6,7,9,10-hexahydro-[1,4]oxazino[2,3-h][3]benzazepine-8-carboxylate |
|---|---|
| PubChem CID | 58495074 |
| Molecular Formula | C22H31BrN2O4 |
| Molecular Weight | 467.40 g/mol |
| Exact Mass | 466.15 |
| IUPAC Name | tert-butyl 5-bromo-4-[[(2R)-oxolan-2-yl]methyl]-2,3,6,7,9,10-hexahydro-[1,4]oxazino[2,3-h][3]benzazepine-8-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCc2cc3c(c(Br)c2CC1)N(C[C@H]1CCCO1)CCO3 |
| InChI | InChI=1S/C22H31BrN2O4/c1-22(2,3)29-21(26)24-8-6-15-13-18-20(19(23)17(15)7-9-24)25(10-12-28-18)14-16-5-4-11-27-16/h13,16H,4-12,14H2,1-3H3/t16-/m1/s1 |
| InChIKey | RFGMEBBTBXJNIV-MRXNPFEDSA-N |
| XLogP | 4.16 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.40 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |