C19H25F3N2O3 — CID 70667135
tert-butyl 4-(2,2,2-trifluoroethyl)-2,3,6,7,9,10-hexahydro-[1,4]oxazino[2,3-h][3]benzazepine-8-carboxylate (PubChem CID 70667135) has the molecular formula C19H25F3N2O3 and a molecular weight of 386.41 g/mol. Its IUPAC name is tert-butyl 4-(2,2,2-trifluoroethyl)-2,3,6,7,9,10-hexahydro-[1,4]oxazino[2,3-h][3]benzazepine-8-carboxylate.
| Compound Name | tert-butyl 4-(2,2,2-trifluoroethyl)-2,3,6,7,9,10-hexahydro-[1,4]oxazino[2,3-h][3]benzazepine-8-carboxylate |
|---|---|
| PubChem CID | 70667135 |
| Molecular Formula | C19H25F3N2O3 |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | tert-butyl 4-(2,2,2-trifluoroethyl)-2,3,6,7,9,10-hexahydro-[1,4]oxazino[2,3-h][3]benzazepine-8-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCc2cc3c(cc2CC1)N(CC(F)(F)F)CCO3 |
| InChI | InChI=1S/C19H25F3N2O3/c1-18(2,3)27-17(25)23-6-4-13-10-15-16(11-14(13)5-7-23)26-9-8-24(15)12-19(20,21)22/h10-11H,4-9,12H2,1-3H3 |
| InChIKey | LPKFFYNAFUDNIZ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |