C26H31FN2O5 — CID 58494687
8-O-tert-butyl 4-O-[2-(4-fluorophenyl)ethyl] 2,3,6,7,9,10-hexahydro-[1,4]oxazino[2,3-h][3]benzazepine-4,8-dicarboxylate (PubChem CID 58494687) has the molecular formula C26H31FN2O5 and a molecular weight of 470.54 g/mol. Its IUPAC name is 8-O-tert-butyl 4-O-[2-(4-fluorophenyl)ethyl] 2,3,6,7,9,10-hexahydro-[1,4]oxazino[2,3-h][3]benzazepine-4,8-dicarboxylate.
| Compound Name | 8-O-tert-butyl 4-O-[2-(4-fluorophenyl)ethyl] 2,3,6,7,9,10-hexahydro-[1,4]oxazino[2,3-h][3]benzazepine-4,8-dicarboxylate |
|---|---|
| PubChem CID | 58494687 |
| Molecular Formula | C26H31FN2O5 |
| Molecular Weight | 470.54 g/mol |
| Exact Mass | 470.22 |
| IUPAC Name | 8-O-tert-butyl 4-O-[2-(4-fluorophenyl)ethyl] 2,3,6,7,9,10-hexahydro-[1,4]oxazino[2,3-h][3]benzazepine-4,8-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCc2cc3c(cc2CC1)N(C(=O)OCCc1ccc(F)cc1)CCO3 |
| InChI | InChI=1S/C26H31FN2O5/c1-26(2,3)34-24(30)28-11-8-19-16-22-23(17-20(19)9-12-28)32-15-13-29(22)25(31)33-14-10-18-4-6-21(27)7-5-18/h4-7,16-17H,8-15H2,1-3H3 |
| InChIKey | QLEVNJKPCVZKFD-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.54 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |