C27H34N2O6 — CID 58495336
8-O-tert-butyl 4-O-[2-(3-methoxyphenyl)ethyl] 2,3,6,7,9,10-hexahydro-[1,4]oxazino[2,3-h][3]benzazepine-4,8-dicarboxylate (PubChem CID 58495336) has the molecular formula C27H34N2O6 and a molecular weight of 482.58 g/mol. Its IUPAC name is 8-O-tert-butyl 4-O-[2-(3-methoxyphenyl)ethyl] 2,3,6,7,9,10-hexahydro-[1,4]oxazino[2,3-h][3]benzazepine-4,8-dicarboxylate.
| Compound Name | 8-O-tert-butyl 4-O-[2-(3-methoxyphenyl)ethyl] 2,3,6,7,9,10-hexahydro-[1,4]oxazino[2,3-h][3]benzazepine-4,8-dicarboxylate |
|---|---|
| PubChem CID | 58495336 |
| Molecular Formula | C27H34N2O6 |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.24 |
| IUPAC Name | 8-O-tert-butyl 4-O-[2-(3-methoxyphenyl)ethyl] 2,3,6,7,9,10-hexahydro-[1,4]oxazino[2,3-h][3]benzazepine-4,8-dicarboxylate |
| SMILES | COc1cccc(CCOC(=O)N2CCOc3cc4c(cc32)CCN(C(=O)OC(C)(C)C)CC4)c1 |
| InChI | InChI=1S/C27H34N2O6/c1-27(2,3)35-25(30)28-11-8-20-17-23-24(18-21(20)9-12-28)33-15-13-29(23)26(31)34-14-10-19-6-5-7-22(16-19)32-4/h5-7,16-18H,8-15H2,1-4H3 |
| InChIKey | OSVUELIOJGLRAC-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |