C20H29FN2O3 — CID 58494863
tert-butyl 4-(3-fluoropropyl)-2,3,6,7,9,10-hexahydro-[1,4]oxazino[2,3-h][3]benzazepine-8-carboxylate (PubChem CID 58494863) has the molecular formula C20H29FN2O3 and a molecular weight of 364.46 g/mol. Its IUPAC name is tert-butyl 4-(3-fluoropropyl)-2,3,6,7,9,10-hexahydro-[1,4]oxazino[2,3-h][3]benzazepine-8-carboxylate.
| Compound Name | tert-butyl 4-(3-fluoropropyl)-2,3,6,7,9,10-hexahydro-[1,4]oxazino[2,3-h][3]benzazepine-8-carboxylate |
|---|---|
| PubChem CID | 58494863 |
| Molecular Formula | C20H29FN2O3 |
| Molecular Weight | 364.46 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | tert-butyl 4-(3-fluoropropyl)-2,3,6,7,9,10-hexahydro-[1,4]oxazino[2,3-h][3]benzazepine-8-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCc2cc3c(cc2CC1)N(CCCF)CCO3 |
| InChI | InChI=1S/C20H29FN2O3/c1-20(2,3)26-19(24)23-9-5-15-13-17-18(14-16(15)6-10-23)25-12-11-22(17)8-4-7-21/h13-14H,4-12H2,1-3H3 |
| InChIKey | BLAYIOOZSRRWIM-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.46 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |