C19H24BrF3N2O3 — CID 70666968
tert-butyl 5-bromo-4-(2,2,2-trifluoroethyl)-2,3,6,7,9,10-hexahydro-[1,4]oxazino[2,3-h][3]benzazepine-8-carboxylate (PubChem CID 70666968) has the molecular formula C19H24BrF3N2O3 and a molecular weight of 465.31 g/mol. Its IUPAC name is tert-butyl 5-bromo-4-(2,2,2-trifluoroethyl)-2,3,6,7,9,10-hexahydro-[1,4]oxazino[2,3-h][3]benzazepine-8-carboxylate.
| Compound Name | tert-butyl 5-bromo-4-(2,2,2-trifluoroethyl)-2,3,6,7,9,10-hexahydro-[1,4]oxazino[2,3-h][3]benzazepine-8-carboxylate |
|---|---|
| PubChem CID | 70666968 |
| Molecular Formula | C19H24BrF3N2O3 |
| Molecular Weight | 465.31 g/mol |
| Exact Mass | 464.09 |
| IUPAC Name | tert-butyl 5-bromo-4-(2,2,2-trifluoroethyl)-2,3,6,7,9,10-hexahydro-[1,4]oxazino[2,3-h][3]benzazepine-8-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCc2cc3c(c(Br)c2CC1)N(CC(F)(F)F)CCO3 |
| InChI | InChI=1S/C19H24BrF3N2O3/c1-18(2,3)28-17(26)24-6-4-12-10-14-16(15(20)13(12)5-7-24)25(8-9-27-14)11-19(21,22)23/h10H,4-9,11H2,1-3H3 |
| InChIKey | ZARUQOCZTABARQ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.31 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |