C23H33BrN2O3 — CID 58495055
tert-butyl 11-bromo-1-[[(2S)-oxolan-2-yl]methyl]-3,4,6,7,9,10-hexahydro-2H-pyrido[3,2-h][3]benzazepine-8-carboxylate (PubChem CID 58495055) has the molecular formula C23H33BrN2O3 and a molecular weight of 465.43 g/mol. Its IUPAC name is tert-butyl 11-bromo-1-[[(2S)-oxolan-2-yl]methyl]-3,4,6,7,9,10-hexahydro-2H-pyrido[3,2-h][3]benzazepine-8-carboxylate.
| Compound Name | tert-butyl 11-bromo-1-[[(2S)-oxolan-2-yl]methyl]-3,4,6,7,9,10-hexahydro-2H-pyrido[3,2-h][3]benzazepine-8-carboxylate |
|---|---|
| PubChem CID | 58495055 |
| Molecular Formula | C23H33BrN2O3 |
| Molecular Weight | 465.43 g/mol |
| Exact Mass | 464.17 |
| IUPAC Name | tert-butyl 11-bromo-1-[[(2S)-oxolan-2-yl]methyl]-3,4,6,7,9,10-hexahydro-2H-pyrido[3,2-h][3]benzazepine-8-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCc2cc3c(c(Br)c2CC1)N(C[C@@H]1CCCO1)CCC3 |
| InChI | InChI=1S/C23H33BrN2O3/c1-23(2,3)29-22(27)25-11-8-16-14-17-6-4-10-26(15-18-7-5-13-28-18)21(17)20(24)19(16)9-12-25/h14,18H,4-13,15H2,1-3H3/t18-/m0/s1 |
| InChIKey | OSQPDCLNISBWER-SFHVURJKSA-N |
| XLogP | 4.72 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.43 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |