C26H33NO2 — CID 58495097
tert-butyl 6-(3-methylphenyl)-1,2,4,5,7,8,9,10-octahydrobenzo[h][3]benzazepine-3-carboxylate (PubChem CID 58495097) has the molecular formula C26H33NO2 and a molecular weight of 391.56 g/mol. Its IUPAC name is tert-butyl 6-(3-methylphenyl)-1,2,4,5,7,8,9,10-octahydrobenzo[h][3]benzazepine-3-carboxylate.
| Compound Name | tert-butyl 6-(3-methylphenyl)-1,2,4,5,7,8,9,10-octahydrobenzo[h][3]benzazepine-3-carboxylate |
|---|---|
| PubChem CID | 58495097 |
| Molecular Formula | C26H33NO2 |
| Molecular Weight | 391.56 g/mol |
| Exact Mass | 391.25 |
| IUPAC Name | tert-butyl 6-(3-methylphenyl)-1,2,4,5,7,8,9,10-octahydrobenzo[h][3]benzazepine-3-carboxylate |
| SMILES | Cc1cccc(-c2c3c(cc4c2CCN(C(=O)OC(C)(C)C)CC4)CCCC3)c1 |
| InChI | InChI=1S/C26H33NO2/c1-18-8-7-10-21(16-18)24-22-11-6-5-9-19(22)17-20-12-14-27(15-13-23(20)24)25(28)29-26(2,3)4/h7-8,10,16-17H,5-6,9,11-15H2,1-4H3 |
| InChIKey | QHNBVLNWGIVTHD-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.56 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |