About 1-bromo-3-methylbenzene;tert-butyl morpholine-4-carboxylate
1-bromo-3-methylbenzene;tert-butyl morpholine-4-carboxylate (PubChem CID 171499341) has the molecular formula C16H24BrNO3
and a molecular weight of 358.28 g/mol. Its IUPAC name is 1-bromo-3-methylbenzene;tert-butyl morpholine-4-carboxylate.
Molecular Properties
| Compound Name | 1-bromo-3-methylbenzene;tert-butyl morpholine-4-carboxylate |
| PubChem CID | 171499341 |
| Molecular Formula | C16H24BrNO3 |
| Molecular Weight | 358.28 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | 1-bromo-3-methylbenzene;tert-butyl morpholine-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCOCC1.Cc1cccc(Br)c1 |
| InChI | InChI=1S/C9H17NO3.C7H7Br/c1-9(2,3)13-8(11)10-4-6-12-7-5-10;1-6-3-2-4-7(8)5-6/h4-7H2,1-3H3;2-5H,1H3 |
| InChIKey | OGXKHGHLGOJKEM-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.28 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-bromo-3-methylbenzene;tert-butyl morpholine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-3-methylbenzene;tert-butyl morpholine-4-carboxylate?
The IUPAC name of 1-bromo-3-methylbenzene;tert-butyl morpholine-4-carboxylate (CID 171499341) is 1-bromo-3-methylbenzene;tert-butyl morpholine-4-carboxylate.
What is the SMILES notation for 1-bromo-3-methylbenzene;tert-butyl morpholine-4-carboxylate?
The canonical SMILES for 1-bromo-3-methylbenzene;tert-butyl morpholine-4-carboxylate is CC(C)(C)OC(=O)N1CCOCC1.Cc1cccc(Br)c1.
What is the InChIKey of 1-bromo-3-methylbenzene;tert-butyl morpholine-4-carboxylate?
The InChIKey is OGXKHGHLGOJKEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO3.C7H7Br/c1-9(2,3)13-8(11)10-4-6-12-7-5-10;1-6-3-2-4-7(8)5-6/h4-7H2,1-3H3;2-5H,1H3.
What are the key properties of 1-bromo-3-methylbenzene;tert-butyl morpholine-4-carboxylate?
1-bromo-3-methylbenzene;tert-butyl morpholine-4-carboxylate has a molecular weight of 358.28 g/mol, XLogP of 4.01, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-3-methylbenzene;tert-butyl morpholine-4-carboxylate is sourced from PubChem (CID 171499341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).