C16H22N2O3 — CID 108959884
2,2-dimethyl-N-(3-methylphenyl)-3-morpholin-4-yl-3-oxopropanamide (PubChem CID 108959884) has the molecular formula C16H22N2O3 and a molecular weight of 290.36 g/mol. Its IUPAC name is 2,2-dimethyl-N-(3-methylphenyl)-3-morpholin-4-yl-3-oxopropanamide.
| Compound Name | 2,2-dimethyl-N-(3-methylphenyl)-3-morpholin-4-yl-3-oxopropanamide |
|---|---|
| PubChem CID | 108959884 |
| Molecular Formula | C16H22N2O3 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | 2,2-dimethyl-N-(3-methylphenyl)-3-morpholin-4-yl-3-oxopropanamide |
| SMILES | Cc1cccc(NC(=O)C(C)(C)C(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C16H22N2O3/c1-12-5-4-6-13(11-12)17-14(19)16(2,3)15(20)18-7-9-21-10-8-18/h4-6,11H,7-10H2,1-3H3,(H,17,19) |
| InChIKey | SBPHWIVHOBXRJR-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|