C18H25N3O4 — CID 108961269
3-(4-acetylpiperazin-1-yl)-N-(3-methoxyphenyl)-2,2-dimethyl-3-oxopropanamide (PubChem CID 108961269) has the molecular formula C18H25N3O4 and a molecular weight of 347.42 g/mol. Its IUPAC name is 3-(4-acetylpiperazin-1-yl)-N-(3-methoxyphenyl)-2,2-dimethyl-3-oxopropanamide.
| Compound Name | 3-(4-acetylpiperazin-1-yl)-N-(3-methoxyphenyl)-2,2-dimethyl-3-oxopropanamide |
|---|---|
| PubChem CID | 108961269 |
| Molecular Formula | C18H25N3O4 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | 3-(4-acetylpiperazin-1-yl)-N-(3-methoxyphenyl)-2,2-dimethyl-3-oxopropanamide |
| SMILES | COc1cccc(NC(=O)C(C)(C)C(=O)N2CCN(C(C)=O)CC2)c1 |
| InChI | InChI=1S/C18H25N3O4/c1-13(22)20-8-10-21(11-9-20)17(24)18(2,3)16(23)19-14-6-5-7-15(12-14)25-4/h5-7,12H,8-11H2,1-4H3,(H,19,23) |
| InChIKey | FTJSLOHDGOIHPX-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|