C18H26N2O3 — CID 108966767
N-(3-methoxyphenyl)-2,2-dimethyl-3-(3-methylpiperidin-1-yl)-3-oxopropanamide (PubChem CID 108966767) has the molecular formula C18H26N2O3 and a molecular weight of 318.42 g/mol. Its IUPAC name is N-(3-methoxyphenyl)-2,2-dimethyl-3-(3-methylpiperidin-1-yl)-3-oxopropanamide.
| Compound Name | N-(3-methoxyphenyl)-2,2-dimethyl-3-(3-methylpiperidin-1-yl)-3-oxopropanamide |
|---|---|
| PubChem CID | 108966767 |
| Molecular Formula | C18H26N2O3 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | N-(3-methoxyphenyl)-2,2-dimethyl-3-(3-methylpiperidin-1-yl)-3-oxopropanamide |
| SMILES | COc1cccc(NC(=O)C(C)(C)C(=O)N2CCCC(C)C2)c1 |
| InChI | InChI=1S/C18H26N2O3/c1-13-7-6-10-20(12-13)17(22)18(2,3)16(21)19-14-8-5-9-15(11-14)23-4/h5,8-9,11,13H,6-7,10,12H2,1-4H3,(H,19,21) |
| InChIKey | XSJFUWGLUWDNJG-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|