C23H36N2O2 — CID 122521703
tert-butyl 11-pentan-3-yl-1,2,3,4,6,7,9,10-octahydropyrido[3,2-h][3]benzazepine-8-carboxylate (PubChem CID 122521703) has the molecular formula C23H36N2O2 and a molecular weight of 372.55 g/mol. Its IUPAC name is tert-butyl 11-pentan-3-yl-1,2,3,4,6,7,9,10-octahydropyrido[3,2-h][3]benzazepine-8-carboxylate.
| Compound Name | tert-butyl 11-pentan-3-yl-1,2,3,4,6,7,9,10-octahydropyrido[3,2-h][3]benzazepine-8-carboxylate |
|---|---|
| PubChem CID | 122521703 |
| Molecular Formula | C23H36N2O2 |
| Molecular Weight | 372.55 g/mol |
| Exact Mass | 372.28 |
| IUPAC Name | tert-butyl 11-pentan-3-yl-1,2,3,4,6,7,9,10-octahydropyrido[3,2-h][3]benzazepine-8-carboxylate |
| SMILES | CCC(CC)c1c2c(cc3c1NCCC3)CCN(C(=O)OC(C)(C)C)CC2 |
| InChI | InChI=1S/C23H36N2O2/c1-6-16(7-2)20-19-11-14-25(22(26)27-23(3,4)5)13-10-17(19)15-18-9-8-12-24-21(18)20/h15-16,24H,6-14H2,1-5H3 |
| InChIKey | XNSJOZNLSREFOM-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.55 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |