C23H32N2O4 — CID 58495179
tert-butyl 2-oxo-1-[[(2R)-oxolan-2-yl]methyl]-3,4,6,7,9,10-hexahydropyrido[3,2-h][3]benzazepine-8-carboxylate (PubChem CID 58495179) has the molecular formula C23H32N2O4 and a molecular weight of 400.52 g/mol. Its IUPAC name is tert-butyl 2-oxo-1-[[(2R)-oxolan-2-yl]methyl]-3,4,6,7,9,10-hexahydropyrido[3,2-h][3]benzazepine-8-carboxylate.
| Compound Name | tert-butyl 2-oxo-1-[[(2R)-oxolan-2-yl]methyl]-3,4,6,7,9,10-hexahydropyrido[3,2-h][3]benzazepine-8-carboxylate |
|---|---|
| PubChem CID | 58495179 |
| Molecular Formula | C23H32N2O4 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.24 |
| IUPAC Name | tert-butyl 2-oxo-1-[[(2R)-oxolan-2-yl]methyl]-3,4,6,7,9,10-hexahydropyrido[3,2-h][3]benzazepine-8-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCc2cc3c(cc2CC1)N(C[C@H]1CCCO1)C(=O)CC3 |
| InChI | InChI=1S/C23H32N2O4/c1-23(2,3)29-22(27)24-10-8-16-13-18-6-7-21(26)25(15-19-5-4-12-28-19)20(18)14-17(16)9-11-24/h13-14,19H,4-12,15H2,1-3H3/t19-/m1/s1 |
| InChIKey | CSPVTPDDXXGSCA-LJQANCHMSA-N |
| XLogP | 3.48 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |