C21H30N2O3 — CID 58494763
tert-butyl 2-oxo-1-propyl-3,4,6,7,9,10-hexahydropyrido[2,3-h][3]benzazepine-8-carboxylate (PubChem CID 58494763) has the molecular formula C21H30N2O3 and a molecular weight of 358.48 g/mol. Its IUPAC name is tert-butyl 2-oxo-1-propyl-3,4,6,7,9,10-hexahydropyrido[2,3-h][3]benzazepine-8-carboxylate.
| Compound Name | tert-butyl 2-oxo-1-propyl-3,4,6,7,9,10-hexahydropyrido[2,3-h][3]benzazepine-8-carboxylate |
|---|---|
| PubChem CID | 58494763 |
| Molecular Formula | C21H30N2O3 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.23 |
| IUPAC Name | tert-butyl 2-oxo-1-propyl-3,4,6,7,9,10-hexahydropyrido[2,3-h][3]benzazepine-8-carboxylate |
| SMILES | CCCN1C(=O)CCc2cc3c(cc21)CCN(C(=O)OC(C)(C)C)CC3 |
| InChI | InChI=1S/C21H30N2O3/c1-5-10-23-18-14-16-9-12-22(20(25)26-21(2,3)4)11-8-15(16)13-17(18)6-7-19(23)24/h13-14H,5-12H2,1-4H3 |
| InChIKey | RBCDSNKMCZPNKY-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |