C24H37IN2O4 — CID 88906945
tert-butyl 1-[1-hydroxybutyl(methyl)-λ3-iodanyl]carbonyl-3,4,6,7,9,10-hexahydro-2H-pyrido[2,3-h][3]benzazepine-8-carboxylate (PubChem CID 88906945) has the molecular formula C24H37IN2O4 and a molecular weight of 544.47 g/mol. Its IUPAC name is tert-butyl 1-[1-hydroxybutyl(methyl)-λ3-iodanyl]carbonyl-3,4,6,7,9,10-hexahydro-2H-pyrido[2,3-h][3]benzazepine-8-carboxylate.
| Compound Name | tert-butyl 1-[1-hydroxybutyl(methyl)-λ3-iodanyl]carbonyl-3,4,6,7,9,10-hexahydro-2H-pyrido[2,3-h][3]benzazepine-8-carboxylate |
|---|---|
| PubChem CID | 88906945 |
| Molecular Formula | C24H37IN2O4 |
| Molecular Weight | 544.47 g/mol |
| Exact Mass | 544.18 |
| IUPAC Name | tert-butyl 1-[1-hydroxybutyl(methyl)-λ3-iodanyl]carbonyl-3,4,6,7,9,10-hexahydro-2H-pyrido[2,3-h][3]benzazepine-8-carboxylate |
| SMILES | CCCC(O)I(C)C(=O)N1CCCc2cc3c(cc21)CCN(C(=O)OC(C)(C)C)CC3 |
| InChI | InChI=1S/C24H37IN2O4/c1-6-8-21(28)25(5)22(29)27-12-7-9-19-15-17-10-13-26(23(30)31-24(2,3)4)14-11-18(17)16-20(19)27/h15-16,21,28H,6-14H2,1-5H3 |
| InChIKey | IGADQWCVWVLYHZ-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.47 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|