C27H34N2O4 — CID 66982565
1-O-benzyl 8-O-tert-butyl 6-methyl-3,4,6,7,9,10-hexahydro-2H-pyrido[2,3-h][3]benzazepine-1,8-dicarboxylate (PubChem CID 66982565) has the molecular formula C27H34N2O4 and a molecular weight of 450.58 g/mol. Its IUPAC name is 1-O-benzyl 8-O-tert-butyl 6-methyl-3,4,6,7,9,10-hexahydro-2H-pyrido[2,3-h][3]benzazepine-1,8-dicarboxylate.
| Compound Name | 1-O-benzyl 8-O-tert-butyl 6-methyl-3,4,6,7,9,10-hexahydro-2H-pyrido[2,3-h][3]benzazepine-1,8-dicarboxylate |
|---|---|
| PubChem CID | 66982565 |
| Molecular Formula | C27H34N2O4 |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.25 |
| IUPAC Name | 1-O-benzyl 8-O-tert-butyl 6-methyl-3,4,6,7,9,10-hexahydro-2H-pyrido[2,3-h][3]benzazepine-1,8-dicarboxylate |
| SMILES | CC1CN(C(=O)OC(C)(C)C)CCc2cc3c(cc21)CCCN3C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C27H34N2O4/c1-19-17-28(25(30)33-27(2,3)4)14-12-21-16-24-22(15-23(19)21)11-8-13-29(24)26(31)32-18-20-9-6-5-7-10-20/h5-7,9-10,15-16,19H,8,11-14,17-18H2,1-4H3 |
| InChIKey | NKXHCYLQKQBJNH-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |