C24H38N2O4 — CID 126703619
tert-butyl 4-(3-methoxy-2,2-dimethylpropyl)-5-methyl-2,3,6,7,9,10-hexahydro-[1,4]oxazino[2,3-h][3]benzazepine-8-carboxylate (PubChem CID 126703619) has the molecular formula C24H38N2O4 and a molecular weight of 418.58 g/mol. Its IUPAC name is tert-butyl 4-(3-methoxy-2,2-dimethylpropyl)-5-methyl-2,3,6,7,9,10-hexahydro-[1,4]oxazino[2,3-h][3]benzazepine-8-carboxylate.
| Compound Name | tert-butyl 4-(3-methoxy-2,2-dimethylpropyl)-5-methyl-2,3,6,7,9,10-hexahydro-[1,4]oxazino[2,3-h][3]benzazepine-8-carboxylate |
|---|---|
| PubChem CID | 126703619 |
| Molecular Formula | C24H38N2O4 |
| Molecular Weight | 418.58 g/mol |
| Exact Mass | 418.28 |
| IUPAC Name | tert-butyl 4-(3-methoxy-2,2-dimethylpropyl)-5-methyl-2,3,6,7,9,10-hexahydro-[1,4]oxazino[2,3-h][3]benzazepine-8-carboxylate |
| SMILES | COCC(C)(C)CN1CCOc2cc3c(c(C)c21)CCN(C(=O)OC(C)(C)C)CC3 |
| InChI | InChI=1S/C24H38N2O4/c1-17-19-9-11-25(22(27)30-23(2,3)4)10-8-18(19)14-20-21(17)26(12-13-29-20)15-24(5,6)16-28-7/h14H,8-13,15-16H2,1-7H3 |
| InChIKey | QOVLJRIRHFDOOW-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.58 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |