C27H34N2O4 — CID 58495276
tert-butyl 4-(2-ethylbenzoyl)-5-methyl-2,3,6,7,9,10-hexahydro-[1,4]oxazino[2,3-h][3]benzazepine-8-carboxylate (PubChem CID 58495276) has the molecular formula C27H34N2O4 and a molecular weight of 450.58 g/mol. Its IUPAC name is tert-butyl 4-(2-ethylbenzoyl)-5-methyl-2,3,6,7,9,10-hexahydro-[1,4]oxazino[2,3-h][3]benzazepine-8-carboxylate.
| Compound Name | tert-butyl 4-(2-ethylbenzoyl)-5-methyl-2,3,6,7,9,10-hexahydro-[1,4]oxazino[2,3-h][3]benzazepine-8-carboxylate |
|---|---|
| PubChem CID | 58495276 |
| Molecular Formula | C27H34N2O4 |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.25 |
| IUPAC Name | tert-butyl 4-(2-ethylbenzoyl)-5-methyl-2,3,6,7,9,10-hexahydro-[1,4]oxazino[2,3-h][3]benzazepine-8-carboxylate |
| SMILES | CCc1ccccc1C(=O)N1CCOc2cc3c(c(C)c21)CCN(C(=O)OC(C)(C)C)CC3 |
| InChI | InChI=1S/C27H34N2O4/c1-6-19-9-7-8-10-22(19)25(30)29-15-16-32-23-17-20-11-13-28(26(31)33-27(3,4)5)14-12-21(20)18(2)24(23)29/h7-10,17H,6,11-16H2,1-5H3 |
| InChIKey | LORNGPIVXINDPE-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |