C14H18ClF3N2O — CID 162312025
4-(2,2,2-trifluoroethyl)-3,6,7,8,9,10-hexahydro-2H-[1,4]oxazino[2,3-h][3]benzazepine;hydrochloride (PubChem CID 162312025) has the molecular formula C14H18ClF3N2O and a molecular weight of 322.76 g/mol. Its IUPAC name is 4-(2,2,2-trifluoroethyl)-3,6,7,8,9,10-hexahydro-2H-[1,4]oxazino[2,3-h][3]benzazepine;hydrochloride.
| Compound Name | 4-(2,2,2-trifluoroethyl)-3,6,7,8,9,10-hexahydro-2H-[1,4]oxazino[2,3-h][3]benzazepine;hydrochloride |
|---|---|
| PubChem CID | 162312025 |
| Molecular Formula | C14H18ClF3N2O |
| Molecular Weight | 322.76 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | 4-(2,2,2-trifluoroethyl)-3,6,7,8,9,10-hexahydro-2H-[1,4]oxazino[2,3-h][3]benzazepine;hydrochloride |
| SMILES | Cl.FC(F)(F)CN1CCOc2cc3c(cc21)CCNCC3 |
| InChI | InChI=1S/C14H17F3N2O.ClH/c15-14(16,17)9-19-5-6-20-13-8-11-2-4-18-3-1-10(11)7-12(13)19;/h7-8,18H,1-6,9H2;1H |
| InChIKey | GBSMLBFKNPXSFH-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.76 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |