C10H9F3N2O3 — CID 16659312
7-nitro-4-(2,2,2-trifluoroethyl)-2,3-dihydro-1,4-benzoxazine (PubChem CID 16659312) has the molecular formula C10H9F3N2O3 and a molecular weight of 262.19 g/mol. Its IUPAC name is 7-nitro-4-(2,2,2-trifluoroethyl)-2,3-dihydro-1,4-benzoxazine.
| Compound Name | 7-nitro-4-(2,2,2-trifluoroethyl)-2,3-dihydro-1,4-benzoxazine |
|---|---|
| PubChem CID | 16659312 |
| Molecular Formula | C10H9F3N2O3 |
| Molecular Weight | 262.19 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | 7-nitro-4-(2,2,2-trifluoroethyl)-2,3-dihydro-1,4-benzoxazine |
| SMILES | O=[N+]([O-])c1ccc2c(c1)OCCN2CC(F)(F)F |
| InChI | InChI=1S/C10H9F3N2O3/c11-10(12,13)6-14-3-4-18-9-5-7(15(16)17)1-2-8(9)14/h1-2,5H,3-4,6H2 |
| InChIKey | OZDHJDLQBODLHU-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.19 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|