C15H19N3O6 — CID 174735072
tert-butyl N-[2-(7-nitro-2,3-dihydro-1,4-benzoxazin-4-yl)-2-oxoethyl]carbamate (PubChem CID 174735072) has the molecular formula C15H19N3O6 and a molecular weight of 337.33 g/mol. Its IUPAC name is tert-butyl N-[2-(7-nitro-2,3-dihydro-1,4-benzoxazin-4-yl)-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-(7-nitro-2,3-dihydro-1,4-benzoxazin-4-yl)-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 174735072 |
| Molecular Formula | C15H19N3O6 |
| Molecular Weight | 337.33 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | tert-butyl N-[2-(7-nitro-2,3-dihydro-1,4-benzoxazin-4-yl)-2-oxoethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(=O)N1CCOc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C15H19N3O6/c1-15(2,3)24-14(20)16-9-13(19)17-6-7-23-12-8-10(18(21)22)4-5-11(12)17/h4-5,8H,6-7,9H2,1-3H3,(H,16,20) |
| InChIKey | ITMWXKLDNUDWIR-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.33 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|