C19H21N5O5 — CID 90771215
tert-butyl N-[2-[7-(3-nitrophenyl)-5H-pyrazolo[1,5-a]pyrimidin-4-yl]-2-oxoethyl]carbamate (PubChem CID 90771215) has the molecular formula C19H21N5O5 and a molecular weight of 399.41 g/mol. Its IUPAC name is tert-butyl N-[2-[7-(3-nitrophenyl)-5H-pyrazolo[1,5-a]pyrimidin-4-yl]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[7-(3-nitrophenyl)-5H-pyrazolo[1,5-a]pyrimidin-4-yl]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 90771215 |
| Molecular Formula | C19H21N5O5 |
| Molecular Weight | 399.41 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | tert-butyl N-[2-[7-(3-nitrophenyl)-5H-pyrazolo[1,5-a]pyrimidin-4-yl]-2-oxoethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(=O)N1CC=C(c2cccc([N+](=O)[O-])c2)n2nccc21 |
| InChI | InChI=1S/C19H21N5O5/c1-19(2,3)29-18(26)20-12-17(25)22-10-8-15(23-16(22)7-9-21-23)13-5-4-6-14(11-13)24(27)28/h4-9,11H,10,12H2,1-3H3,(H,20,26) |
| InChIKey | GTTRFKWKZYEPKG-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 119.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.41 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|