C21H25NO4 — CID 156801421
tert-butyl 2,2-dimethyl-3-[4-(3-nitrophenyl)phenyl]propanoate (PubChem CID 156801421) has the molecular formula C21H25NO4 and a molecular weight of 355.43 g/mol. Its IUPAC name is tert-butyl 2,2-dimethyl-3-[4-(3-nitrophenyl)phenyl]propanoate.
| Compound Name | tert-butyl 2,2-dimethyl-3-[4-(3-nitrophenyl)phenyl]propanoate |
|---|---|
| PubChem CID | 156801421 |
| Molecular Formula | C21H25NO4 |
| Molecular Weight | 355.43 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | tert-butyl 2,2-dimethyl-3-[4-(3-nitrophenyl)phenyl]propanoate |
| SMILES | CC(C)(C)OC(=O)C(C)(C)Cc1ccc(-c2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C21H25NO4/c1-20(2,3)26-19(23)21(4,5)14-15-9-11-16(12-10-15)17-7-6-8-18(13-17)22(24)25/h6-13H,14H2,1-5H3 |
| InChIKey | HUYKOMMIFIJBDK-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.43 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|