C26H28N2O5 — CID 58020362
tert-butyl N-[[3-[[4-methoxy-3-(3-nitrophenyl)phenyl]methyl]phenyl]methyl]carbamate (PubChem CID 58020362) has the molecular formula C26H28N2O5 and a molecular weight of 448.52 g/mol. Its IUPAC name is tert-butyl N-[[3-[[4-methoxy-3-(3-nitrophenyl)phenyl]methyl]phenyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[3-[[4-methoxy-3-(3-nitrophenyl)phenyl]methyl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 58020362 |
| Molecular Formula | C26H28N2O5 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | tert-butyl N-[[3-[[4-methoxy-3-(3-nitrophenyl)phenyl]methyl]phenyl]methyl]carbamate |
| SMILES | COc1ccc(Cc2cccc(CNC(=O)OC(C)(C)C)c2)cc1-c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C26H28N2O5/c1-26(2,3)33-25(29)27-17-20-8-5-7-18(14-20)13-19-11-12-24(32-4)23(15-19)21-9-6-10-22(16-21)28(30)31/h5-12,14-16H,13,17H2,1-4H3,(H,27,29) |
| InChIKey | BVQCNGZYYKTOGM-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|