C21H27NO2 — CID 156541165
butyl 3-[4-(3-aminophenyl)phenyl]-2,2-dimethylpropanoate (PubChem CID 156541165) has the molecular formula C21H27NO2 and a molecular weight of 325.45 g/mol. Its IUPAC name is butyl 3-[4-(3-aminophenyl)phenyl]-2,2-dimethylpropanoate.
| Compound Name | butyl 3-[4-(3-aminophenyl)phenyl]-2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 156541165 |
| Molecular Formula | C21H27NO2 |
| Molecular Weight | 325.45 g/mol |
| Exact Mass | 325.20 |
| IUPAC Name | butyl 3-[4-(3-aminophenyl)phenyl]-2,2-dimethylpropanoate |
| SMILES | CCCCOC(=O)C(C)(C)Cc1ccc(-c2cccc(N)c2)cc1 |
| InChI | InChI=1S/C21H27NO2/c1-4-5-13-24-20(23)21(2,3)15-16-9-11-17(12-10-16)18-7-6-8-19(22)14-18/h6-12,14H,4-5,13,15,22H2,1-3H3 |
| InChIKey | OAOMEPTYZXIUQO-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.45 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|