C19H22ClFN2O2 — CID 156801442
butyl 3-[3-(2-chloro-5-fluoropyrimidin-4-yl)phenyl]-2,2-dimethylpropanoate (PubChem CID 156801442) has the molecular formula C19H22ClFN2O2 and a molecular weight of 364.85 g/mol. Its IUPAC name is butyl 3-[3-(2-chloro-5-fluoropyrimidin-4-yl)phenyl]-2,2-dimethylpropanoate.
| Compound Name | butyl 3-[3-(2-chloro-5-fluoropyrimidin-4-yl)phenyl]-2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 156801442 |
| Molecular Formula | C19H22ClFN2O2 |
| Molecular Weight | 364.85 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | butyl 3-[3-(2-chloro-5-fluoropyrimidin-4-yl)phenyl]-2,2-dimethylpropanoate |
| SMILES | CCCCOC(=O)C(C)(C)Cc1cccc(-c2nc(Cl)ncc2F)c1 |
| InChI | InChI=1S/C19H22ClFN2O2/c1-4-5-9-25-17(24)19(2,3)11-13-7-6-8-14(10-13)16-15(21)12-22-18(20)23-16/h6-8,10,12H,4-5,9,11H2,1-3H3 |
| InChIKey | YCTUAOSJFXZYPW-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.85 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|