C28H34ClF2N5O4S — CID 155263691
tert-butyl N-[[3-amino-5-[5-[5-(2-chloro-5-fluoropyrimidin-4-yl)-2-fluoroanilino]pentoxy]phenyl]methyl-methyl-oxo-λ6-sulfanylidene]carbamate (PubChem CID 155263691) has the molecular formula C28H34ClF2N5O4S and a molecular weight of 610.13 g/mol. Its IUPAC name is tert-butyl N-[[3-amino-5-[5-[5-(2-chloro-5-fluoropyrimidin-4-yl)-2-fluoroanilino]pentoxy]phenyl]methyl-methyl-oxo-λ6-sulfanylidene]carbamate.
| Compound Name | tert-butyl N-[[3-amino-5-[5-[5-(2-chloro-5-fluoropyrimidin-4-yl)-2-fluoroanilino]pentoxy]phenyl]methyl-methyl-oxo-λ6-sulfanylidene]carbamate |
|---|---|
| PubChem CID | 155263691 |
| Molecular Formula | C28H34ClF2N5O4S |
| Molecular Weight | 610.13 g/mol |
| Exact Mass | 609.20 |
| IUPAC Name | tert-butyl N-[[3-amino-5-[5-[5-(2-chloro-5-fluoropyrimidin-4-yl)-2-fluoroanilino]pentoxy]phenyl]methyl-methyl-oxo-λ6-sulfanylidene]carbamate |
| SMILES | CC(C)(C)OC(=O)N=S(C)(=O)Cc1cc(N)cc(OCCCCCNc2cc(-c3nc(Cl)ncc3F)ccc2F)c1 |
| InChI | InChI=1S/C28H34ClF2N5O4S/c1-28(2,3)40-27(37)36-41(4,38)17-18-12-20(32)15-21(13-18)39-11-7-5-6-10-33-24-14-19(8-9-22(24)30)25-23(31)16-34-26(29)35-25/h8-9,12-16,33H,5-7,10-11,17,32H2,1-4H3 |
| InChIKey | CKXAEXBKXAFMLE-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 128.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.13 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|