C17H28N2O6S — CID 140918502
[3-(4-hydroxybutoxy)-5-[[S-methyl-N-[(2-methylpropan-2-yl)oxycarbonyl]sulfonimidoyl]methyl]phenyl]-oxidoazanium (PubChem CID 140918502) has the molecular formula C17H28N2O6S and a molecular weight of 388.49 g/mol. Its IUPAC name is [3-(4-hydroxybutoxy)-5-[[S-methyl-N-[(2-methylpropan-2-yl)oxycarbonyl]sulfonimidoyl]methyl]phenyl]-oxidoazanium.
| Compound Name | [3-(4-hydroxybutoxy)-5-[[S-methyl-N-[(2-methylpropan-2-yl)oxycarbonyl]sulfonimidoyl]methyl]phenyl]-oxidoazanium |
|---|---|
| PubChem CID | 140918502 |
| Molecular Formula | C17H28N2O6S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | [3-(4-hydroxybutoxy)-5-[[S-methyl-N-[(2-methylpropan-2-yl)oxycarbonyl]sulfonimidoyl]methyl]phenyl]-oxidoazanium |
| SMILES | CC(C)(C)OC(=O)N=S(C)(=O)Cc1cc([NH2+][O-])cc(OCCCCO)c1 |
| InChI | InChI=1S/C17H28N2O6S/c1-17(2,3)25-16(21)19-26(4,23)12-13-9-14(18-22)11-15(10-13)24-8-6-5-7-20/h9-11,20H,5-8,12,18H2,1-4H3 |
| InChIKey | MQVBBVRIVIYTDG-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 124.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|