C17H26N2O6S — CID 155052124
tert-butyl N-[[3-(4-hydroxybutoxy)-5-nitrosophenyl]methyl-methyl-oxo-λ6-sulfanylidene]carbamate (PubChem CID 155052124) has the molecular formula C17H26N2O6S and a molecular weight of 386.47 g/mol. Its IUPAC name is tert-butyl N-[[3-(4-hydroxybutoxy)-5-nitrosophenyl]methyl-methyl-oxo-λ6-sulfanylidene]carbamate.
| Compound Name | tert-butyl N-[[3-(4-hydroxybutoxy)-5-nitrosophenyl]methyl-methyl-oxo-λ6-sulfanylidene]carbamate |
|---|---|
| PubChem CID | 155052124 |
| Molecular Formula | C17H26N2O6S |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | tert-butyl N-[[3-(4-hydroxybutoxy)-5-nitrosophenyl]methyl-methyl-oxo-λ6-sulfanylidene]carbamate |
| SMILES | CC(C)(C)OC(=O)N=S(C)(=O)Cc1cc(N=O)cc(OCCCCO)c1 |
| InChI | InChI=1S/C17H26N2O6S/c1-17(2,3)25-16(21)19-26(4,23)12-13-9-14(18-22)11-15(10-13)24-8-6-5-7-20/h9-11,20H,5-8,12H2,1-4H3 |
| InChIKey | CORWDUKORSCTDJ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 114.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|