C27H31ClF2N4O5S — CID 142438638
tert-butyl N-[[2-[4-[5-(2-amino-5-fluoro-4-pyridinyl)-2-fluorophenoxy]butoxy]-6-chloro-4-pyridinyl]methyl-methyl-oxo-λ6-sulfanylidene]carbamate (PubChem CID 142438638) has the molecular formula C27H31ClF2N4O5S and a molecular weight of 597.08 g/mol. Its IUPAC name is tert-butyl N-[[2-[4-[5-(2-amino-5-fluoro-4-pyridinyl)-2-fluorophenoxy]butoxy]-6-chloro-4-pyridinyl]methyl-methyl-oxo-λ6-sulfanylidene]carbamate.
| Compound Name | tert-butyl N-[[2-[4-[5-(2-amino-5-fluoro-4-pyridinyl)-2-fluorophenoxy]butoxy]-6-chloro-4-pyridinyl]methyl-methyl-oxo-λ6-sulfanylidene]carbamate |
|---|---|
| PubChem CID | 142438638 |
| Molecular Formula | C27H31ClF2N4O5S |
| Molecular Weight | 597.08 g/mol |
| Exact Mass | 596.17 |
| IUPAC Name | tert-butyl N-[[2-[4-[5-(2-amino-5-fluoro-4-pyridinyl)-2-fluorophenoxy]butoxy]-6-chloro-4-pyridinyl]methyl-methyl-oxo-λ6-sulfanylidene]carbamate |
| SMILES | CC(C)(C)OC(=O)N=S(C)(=O)Cc1cc(Cl)nc(OCCCCOc2cc(-c3cc(N)ncc3F)ccc2F)c1 |
| InChI | InChI=1S/C27H31ClF2N4O5S/c1-27(2,3)39-26(35)34-40(4,36)16-17-11-23(28)33-25(12-17)38-10-6-5-9-37-22-13-18(7-8-20(22)29)19-14-24(31)32-15-21(19)30/h7-8,11-15H,5-6,9-10,16H2,1-4H3,(H2,31,32) |
| InChIKey | MOHGUIYDWPTCSB-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 125.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.08 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|