C17H28N2O5S — CID 171621705
tert-butyl N-[[3-amino-5-(4-hydroxybutoxy)phenyl]methyl-methyl-oxo-λ6-sulfanylidene]carbamate (PubChem CID 171621705) has the molecular formula C17H28N2O5S and a molecular weight of 372.49 g/mol. Its IUPAC name is tert-butyl N-[[3-amino-5-(4-hydroxybutoxy)phenyl]methyl-methyl-oxo-λ6-sulfanylidene]carbamate.
| Compound Name | tert-butyl N-[[3-amino-5-(4-hydroxybutoxy)phenyl]methyl-methyl-oxo-λ6-sulfanylidene]carbamate |
|---|---|
| PubChem CID | 171621705 |
| Molecular Formula | C17H28N2O5S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | tert-butyl N-[[3-amino-5-(4-hydroxybutoxy)phenyl]methyl-methyl-oxo-λ6-sulfanylidene]carbamate |
| SMILES | CC(C)(C)OC(=O)N=[S@](C)(=O)Cc1cc(N)cc(OCCCCO)c1 |
| InChI | InChI=1S/C17H28N2O5S/c1-17(2,3)24-16(21)19-25(4,22)12-13-9-14(18)11-15(10-13)23-8-6-5-7-20/h9-11,20H,5-8,12,18H2,1-4H3/t25-/m1/s1 |
| InChIKey | IPSJQFXQELOIRW-RUZDIDTESA-N |
| XLogP | 2.95 |
| TPSA | 111.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|