C16H26N2O6S — CID 129022717
propan-2-yl N-[[3-(hydroxyamino)-5-(4-hydroxybutoxy)phenyl]methyl-methyl-oxo-λ6-sulfanylidene]carbamate (PubChem CID 129022717) has the molecular formula C16H26N2O6S and a molecular weight of 374.46 g/mol. Its IUPAC name is propan-2-yl N-[[3-(hydroxyamino)-5-(4-hydroxybutoxy)phenyl]methyl-methyl-oxo-λ6-sulfanylidene]carbamate.
| Compound Name | propan-2-yl N-[[3-(hydroxyamino)-5-(4-hydroxybutoxy)phenyl]methyl-methyl-oxo-λ6-sulfanylidene]carbamate |
|---|---|
| PubChem CID | 129022717 |
| Molecular Formula | C16H26N2O6S |
| Molecular Weight | 374.46 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | propan-2-yl N-[[3-(hydroxyamino)-5-(4-hydroxybutoxy)phenyl]methyl-methyl-oxo-λ6-sulfanylidene]carbamate |
| SMILES | CC(C)OC(=O)N=S(C)(=O)Cc1cc(NO)cc(OCCCCO)c1 |
| InChI | InChI=1S/C16H26N2O6S/c1-12(2)24-16(20)18-25(3,22)11-13-8-14(17-21)10-15(9-13)23-7-5-4-6-19/h8-10,12,17,19,21H,4-7,11H2,1-3H3 |
| InChIKey | JOOAPZGLODHSBN-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 117.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.46 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|