C22H22ClF2N3O2S — CID 118437102
4-[2-[4-[[6-chloro-4-(methylsulfanylmethyl)-2-pyridinyl]oxy]butoxy]-4-fluorophenyl]-5-fluoropyridin-2-amine (PubChem CID 118437102) has the molecular formula C22H22ClF2N3O2S and a molecular weight of 465.95 g/mol. Its IUPAC name is 4-[2-[4-[[6-chloro-4-(methylsulfanylmethyl)-2-pyridinyl]oxy]butoxy]-4-fluorophenyl]-5-fluoropyridin-2-amine.
| Compound Name | 4-[2-[4-[[6-chloro-4-(methylsulfanylmethyl)-2-pyridinyl]oxy]butoxy]-4-fluorophenyl]-5-fluoropyridin-2-amine |
|---|---|
| PubChem CID | 118437102 |
| Molecular Formula | C22H22ClF2N3O2S |
| Molecular Weight | 465.95 g/mol |
| Exact Mass | 465.11 |
| IUPAC Name | 4-[2-[4-[[6-chloro-4-(methylsulfanylmethyl)-2-pyridinyl]oxy]butoxy]-4-fluorophenyl]-5-fluoropyridin-2-amine |
| SMILES | CSCc1cc(Cl)nc(OCCCCOc2cc(F)ccc2-c2cc(N)ncc2F)c1 |
| InChI | InChI=1S/C22H22ClF2N3O2S/c1-31-13-14-8-20(23)28-22(9-14)30-7-3-2-6-29-19-10-15(24)4-5-16(19)17-11-21(26)27-12-18(17)25/h4-5,8-12H,2-3,6-7,13H2,1H3,(H2,26,27) |
| InChIKey | NCLDNXJFOHCTPX-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 70.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.95 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|