C23H23ClF2N4O3S — CID 154032358
5-(2-chloro-5-fluoropyrimidin-4-yl)-2-fluoro-N-[4-[3-(methylsulfanylmethyl)-5-nitrophenoxy]pentyl]aniline (PubChem CID 154032358) has the molecular formula C23H23ClF2N4O3S and a molecular weight of 508.98 g/mol. Its IUPAC name is 5-(2-chloro-5-fluoropyrimidin-4-yl)-2-fluoro-N-[4-[3-(methylsulfanylmethyl)-5-nitrophenoxy]pentyl]aniline.
| Compound Name | 5-(2-chloro-5-fluoropyrimidin-4-yl)-2-fluoro-N-[4-[3-(methylsulfanylmethyl)-5-nitrophenoxy]pentyl]aniline |
|---|---|
| PubChem CID | 154032358 |
| Molecular Formula | C23H23ClF2N4O3S |
| Molecular Weight | 508.98 g/mol |
| Exact Mass | 508.11 |
| IUPAC Name | 5-(2-chloro-5-fluoropyrimidin-4-yl)-2-fluoro-N-[4-[3-(methylsulfanylmethyl)-5-nitrophenoxy]pentyl]aniline |
| SMILES | CSCc1cc(OC(C)CCCNc2cc(-c3nc(Cl)ncc3F)ccc2F)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H23ClF2N4O3S/c1-14(33-18-9-15(13-34-2)8-17(11-18)30(31)32)4-3-7-27-21-10-16(5-6-19(21)25)22-20(26)12-28-23(24)29-22/h5-6,8-12,14,27H,3-4,7,13H2,1-2H3 |
| InChIKey | UMJXHLCMVNSVJC-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 90.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.98 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|