C29H37NO6SSi — CID 142438604
tert-butyl-[4-[3-(methylsulfonylmethyl)-5-nitrophenoxy]pentoxy]-diphenylsilane (PubChem CID 142438604) has the molecular formula C29H37NO6SSi and a molecular weight of 555.77 g/mol. Its IUPAC name is tert-butyl-[4-[3-(methylsulfonylmethyl)-5-nitrophenoxy]pentoxy]-diphenylsilane.
| Compound Name | tert-butyl-[4-[3-(methylsulfonylmethyl)-5-nitrophenoxy]pentoxy]-diphenylsilane |
|---|---|
| PubChem CID | 142438604 |
| Molecular Formula | C29H37NO6SSi |
| Molecular Weight | 555.77 g/mol |
| Exact Mass | 555.21 |
| IUPAC Name | tert-butyl-[4-[3-(methylsulfonylmethyl)-5-nitrophenoxy]pentoxy]-diphenylsilane |
| SMILES | CC(CCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)Oc1cc(CS(C)(=O)=O)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C29H37NO6SSi/c1-23(36-26-20-24(22-37(5,33)34)19-25(21-26)30(31)32)13-12-18-35-38(29(2,3)4,27-14-8-6-9-15-27)28-16-10-7-11-17-28/h6-11,14-17,19-21,23H,12-13,18,22H2,1-5H3 |
| InChIKey | SLAFCFJBMQBITM-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.77 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|