C28H35NO5SSi — CID 172547740
tert-butyl-[(3S)-3-[3-(methylsulfinylmethyl)-5-nitrophenoxy]butoxy]-diphenylsilane (PubChem CID 172547740) has the molecular formula C28H35NO5SSi and a molecular weight of 525.74 g/mol. Its IUPAC name is tert-butyl-[(3S)-3-[3-(methylsulfinylmethyl)-5-nitrophenoxy]butoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(3S)-3-[3-(methylsulfinylmethyl)-5-nitrophenoxy]butoxy]-diphenylsilane |
|---|---|
| PubChem CID | 172547740 |
| Molecular Formula | C28H35NO5SSi |
| Molecular Weight | 525.74 g/mol |
| Exact Mass | 525.20 |
| IUPAC Name | tert-butyl-[(3S)-3-[3-(methylsulfinylmethyl)-5-nitrophenoxy]butoxy]-diphenylsilane |
| SMILES | C[C@@H](CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)Oc1cc(CS(C)=O)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C28H35NO5SSi/c1-22(34-25-19-23(21-35(5)32)18-24(20-25)29(30)31)16-17-33-36(28(2,3)4,26-12-8-6-9-13-26)27-14-10-7-11-15-27/h6-15,18-20,22H,16-17,21H2,1-5H3/t22-,35?/m0/s1 |
| InChIKey | PLOBTTVOMKCJNW-DAJKIOHCSA-N |
| XLogP | 5.21 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.74 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|