C21H23ClN4O3 — CID 67198645
tert-butyl N-[2-[3-(2-amino-6-chloroquinazolin-4-yl)phenoxy]ethyl]carbamate (PubChem CID 67198645) has the molecular formula C21H23ClN4O3 and a molecular weight of 414.89 g/mol. Its IUPAC name is tert-butyl N-[2-[3-(2-amino-6-chloroquinazolin-4-yl)phenoxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[3-(2-amino-6-chloroquinazolin-4-yl)phenoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 67198645 |
| Molecular Formula | C21H23ClN4O3 |
| Molecular Weight | 414.89 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | tert-butyl N-[2-[3-(2-amino-6-chloroquinazolin-4-yl)phenoxy]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCOc1cccc(-c2nc(N)nc3ccc(Cl)cc23)c1 |
| InChI | InChI=1S/C21H23ClN4O3/c1-21(2,3)29-20(27)24-9-10-28-15-6-4-5-13(11-15)18-16-12-14(22)7-8-17(16)25-19(23)26-18/h4-8,11-12H,9-10H2,1-3H3,(H,24,27)(H2,23,25,26) |
| InChIKey | VAYOHWBMGIUQCC-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 99.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.89 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|